C19H20ClN3O2 — CID 110121599
[(3aS,4S,6aR)-4-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methylpyrimidin-4-yl)methanone (PubChem CID 110121599) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methylpyrimidin-4-yl)methanone.
| Compound Name | [(3aS,4S,6aR)-4-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 110121599 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(3aS,4S,6aR)-4-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methylpyrimidin-4-yl)methanone |
| SMILES | Cc1nccc(C(=O)N2C[C@@H]3CC[C@H](Oc4ccccc4Cl)[C@@H]3C2)n1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-12-21-9-8-16(22-12)19(24)23-10-13-6-7-17(14(13)11-23)25-18-5-3-2-4-15(18)20/h2-5,8-9,13-14,17H,6-7,10-11H2,1H3/t13-,14+,17-/m0/s1 |
| InChIKey | WYCZHDGNVCDCHQ-VBQJREDUSA-N |
| XLogP | 3.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |