C12H19N4O+ — CID 123694464
(4,4-dimethylpiperazin-4-ium-1-yl)-(2-methylpyrimidin-4-yl)methanone (PubChem CID 123694464) has the molecular formula C12H19N4O+ and a molecular weight of 235.31 g/mol. Its IUPAC name is (4,4-dimethylpiperazin-4-ium-1-yl)-(2-methylpyrimidin-4-yl)methanone.
| Compound Name | (4,4-dimethylpiperazin-4-ium-1-yl)-(2-methylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 123694464 |
| Molecular Formula | C12H19N4O+ |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (4,4-dimethylpiperazin-4-ium-1-yl)-(2-methylpyrimidin-4-yl)methanone |
| SMILES | Cc1nccc(C(=O)N2CC[N+](C)(C)CC2)n1 |
| InChI | InChI=1S/C12H19N4O/c1-10-13-5-4-11(14-10)12(17)15-6-8-16(2,3)9-7-15/h4-5H,6-9H2,1-3H3/q+1 |
| InChIKey | UCZDLELNOAGXEM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|