C13H20N4O2 — CID 56802501
[4-(2-hydroxypropyl)piperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone (PubChem CID 56802501) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is [4-(2-hydroxypropyl)piperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone.
| Compound Name | [4-(2-hydroxypropyl)piperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 56802501 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [4-(2-hydroxypropyl)piperazin-1-yl]-(2-methylpyrimidin-4-yl)methanone |
| SMILES | Cc1nccc(C(=O)N2CCN(CC(C)O)CC2)n1 |
| InChI | InChI=1S/C13H20N4O2/c1-10(18)9-16-5-7-17(8-6-16)13(19)12-3-4-14-11(2)15-12/h3-4,10,18H,5-9H2,1-2H3 |
| InChIKey | IRGIZYIOEHLOIO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |