C21H25N3O2 — CID 97458226
[(3aR,4R,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 97458226) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3aR,4R,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [(3aR,4R,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 97458226 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | [(3aR,4R,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3CCC[C@@H](OCc4cccnc4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-7-8-17(11-23-15)21(25)24-12-18-5-2-6-20(19(18)13-24)26-14-16-4-3-9-22-10-16/h3-4,7-11,18-20H,2,5-6,12-14H2,1H3/t18-,19+,20-/m1/s1 |
| InChIKey | KKOMQMAXQBVJCT-HSALFYBXSA-N |
| XLogP | 3.24 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |