C19H21N3O3 — CID 133136527
[(3R,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 133136527) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [(3R,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 133136527 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(3R,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@@H](Oc3cccnc3)[C@@H]3OCCC[C@@H]32)cn1 |
| InChI | InChI=1S/C19H21N3O3/c1-13-6-7-14(10-21-13)19(23)22-12-17(18-16(22)5-3-9-24-18)25-15-4-2-8-20-11-15/h2,4,6-8,10-11,16-18H,3,5,9,12H2,1H3/t16-,17+,18+/m0/s1 |
| InChIKey | VCJLUVUKPFMHKP-RCCFBDPRSA-N |
| XLogP | 2.24 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |