C17H19N3O3 — CID 131683319
[(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 131683319) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 131683319 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1C[C@H](Oc2cccnc2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C17H19N3O3/c21-17(12-5-7-19-9-12)20-11-15(16-14(20)4-2-8-22-16)23-13-3-1-6-18-10-13/h1,3,5-7,9-10,14-16,19H,2,4,8,11H2/t14-,15+,16+/m1/s1 |
| InChIKey | NBHOZLDGKDSVJL-PMPSAXMXSA-N |
| XLogP | 1.86 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |