C22H26N2O2 — CID 97458213
[(3aR,4S,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylphenyl)methanone (PubChem CID 97458213) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(3aR,4S,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [(3aR,4S,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 97458213 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | [(3aR,4S,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3CCC[C@H](OCc4cccnc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-16-7-9-18(10-8-16)22(25)24-13-19-5-2-6-21(20(19)14-24)26-15-17-4-3-11-23-12-17/h3-4,7-12,19-21H,2,5-6,13-15H2,1H3/t19-,20+,21+/m1/s1 |
| InChIKey | AERKBLFQZYIQPF-HKBOAZHASA-N |
| XLogP | 3.85 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |