C20H26F4N2O5 — CID 155845608
[(3aR,7R,7aR)-2-(furan-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155845608) has the molecular formula C20H26F4N2O5 and a molecular weight of 450.43 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-(furan-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7R,7aR)-2-(furan-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845608 |
| Molecular Formula | C20H26F4N2O5 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [(3aR,7R,7aR)-2-(furan-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@H]1COC[C@H]2CN(Cc3ccoc3)C[C@H]21)N1CCC(F)CC1 |
| InChI | InChI=1S/C18H25FN2O3.C2HF3O2/c19-15-1-4-21(5-2-15)18(22)17-12-24-11-14-8-20(9-16(14)17)7-13-3-6-23-10-13;3-2(4,5)1(6)7/h3,6,10,14-17H,1-2,4-5,7-9,11-12H2;(H,6,7)/t14-,16-,17+;/m1./s1 |
| InChIKey | TZAFUGBOXINSBJ-WBWOGKSNSA-N |
| XLogP | 2.57 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |