C18H25FN2O3 — CID 97362646
[(3aR,7S,7aR)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone (PubChem CID 97362646) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone.
| Compound Name | [(3aR,7S,7aR)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 97362646 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(3aR,7S,7aR)-2-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone |
| SMILES | O=C([C@@H]1COC[C@H]2CN(Cc3ccco3)C[C@H]21)N1CCC(F)CC1 |
| InChI | InChI=1S/C18H25FN2O3/c19-14-3-5-21(6-4-14)18(22)17-12-23-11-13-8-20(10-16(13)17)9-15-2-1-7-24-15/h1-2,7,13-14,16-17H,3-6,8-12H2/t13-,16-,17-/m1/s1 |
| InChIKey | GWEABCBWZJJOCW-KBRIMQKVSA-N |
| XLogP | 1.93 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |