C19H27N3O3 — CID 97364621
[(3aR,7R,7aR)-2-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone (PubChem CID 97364621) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,7R,7aR)-2-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97364621 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [(3aR,7R,7aR)-2-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cccc(CN2C[C@@H]3COC[C@H](C(=O)N4CCOCC4)[C@@H]3C2)n1 |
| InChI | InChI=1S/C19H27N3O3/c1-14-3-2-4-16(20-14)10-21-9-15-12-25-13-18(17(15)11-21)19(23)22-5-7-24-8-6-22/h2-4,15,17-18H,5-13H2,1H3/t15-,17-,18+/m1/s1 |
| InChIKey | HPDVAEQAJXFGJX-NXHRZFHOSA-N |
| XLogP | 0.94 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |