C18H26N2O3 — CID 97367149
[(4R,4aS,8aR)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 97367149) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [(4R,4aS,8aR)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4R,4aS,8aR)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 97367149 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(4R,4aS,8aR)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CCO[C@@H]2CCN(Cc3ccoc3)C[C@@H]21)N1CCCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-18(20-6-1-2-7-20)15-5-10-23-17-3-8-19(12-16(15)17)11-14-4-9-22-13-14/h4,9,13,15-17H,1-3,5-8,10-12H2/t15-,16-,17-/m1/s1 |
| InChIKey | MZHXUVCNBOVNBQ-BRWVUGGUSA-N |
| XLogP | 2.13 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |