C20H26ClF3N2O4 — CID 155843038
2-[(1R,3aR,7aR)-5-[(2-chlorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155843038) has the molecular formula C20H26ClF3N2O4 and a molecular weight of 450.89 g/mol. Its IUPAC name is 2-[(1R,3aR,7aR)-5-[(2-chlorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,3aR,7aR)-5-[(2-chlorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843038 |
| Molecular Formula | C20H26ClF3N2O4 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[(1R,3aR,7aR)-5-[(2-chlorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)C[C@H]1OC[C@H]2CN(Cc3ccccc3Cl)CC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25ClN2O2.C2HF3O2/c1-20(2)18(22)9-17-15-7-8-21(11-14(15)12-23-17)10-13-5-3-4-6-16(13)19;3-2(4,5)1(6)7/h3-6,14-15,17H,7-12H2,1-2H3;(H,6,7)/t14-,15-,17-;/m1./s1 |
| InChIKey | HTFMESWXHPIBBT-VVXOQCHWSA-N |
| XLogP | 3.29 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |