C20H28N2O3 — CID 97476485
2-[(1S,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide (PubChem CID 97476485) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[(1S,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[(1S,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 97476485 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[(1S,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide |
| SMILES | COc1ccccc1CN1CC[C@@H]2[C@@H](CO[C@H]2CC(=O)NC2CC2)C1 |
| InChI | InChI=1S/C20H28N2O3/c1-24-18-5-3-2-4-14(18)11-22-9-8-17-15(12-22)13-25-19(17)10-20(23)21-16-6-7-16/h2-5,15-17,19H,6-13H2,1H3,(H,21,23)/t15-,17-,19+/m1/s1 |
| InChIKey | CNEJWQMTPYFXSB-SUMDDJOVSA-N |
| XLogP | 2.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |