C22H29F3N2O5 — CID 155825750
2-[(1R,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155825750) has the molecular formula C22H29F3N2O5 and a molecular weight of 458.48 g/mol. Its IUPAC name is 2-[(1R,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825750 |
| Molecular Formula | C22H29F3N2O5 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[(1R,3aR,7aR)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccccc1CN1CC[C@@H]2[C@@H](CO[C@@H]2CC(=O)NC2CC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N2O3.C2HF3O2/c1-24-18-5-3-2-4-14(18)11-22-9-8-17-15(12-22)13-25-19(17)10-20(23)21-16-6-7-16;3-2(4,5)1(6)7/h2-5,15-17,19H,6-13H2,1H3,(H,21,23);(H,6,7)/t15-,17-,19-;/m1./s1 |
| InChIKey | RRAKVZDPBMYFRL-YFLXZMGJSA-N |
| XLogP | 2.83 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |