C22H29F3N2O5 — CID 127023687
[(2S,3aS,7aR)-6-[(2-methoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 127023687) has the molecular formula C22H29F3N2O5 and a molecular weight of 458.48 g/mol. Its IUPAC name is [(2S,3aS,7aR)-6-[(2-methoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,3aS,7aR)-6-[(2-methoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023687 |
| Molecular Formula | C22H29F3N2O5 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | [(2S,3aS,7aR)-6-[(2-methoxyphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccccc1CN1CC[C@H]2C[C@@H](C(=O)N3CCCC3)O[C@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N2O3.C2HF3O2/c1-24-17-7-3-2-6-16(17)13-21-11-8-15-12-18(25-19(15)14-21)20(23)22-9-4-5-10-22;3-2(4,5)1(6)7/h2-3,6-7,15,18-19H,4-5,8-14H2,1H3;(H,6,7)/t15-,18-,19-;/m0./s1 |
| InChIKey | QPTZBWGDJHTTMP-HIKKPYDISA-N |
| XLogP | 2.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |