C15H19FN2O2 — CID 97419386
(5aR,9aR)-4-[(3-fluorophenyl)methyl]-2,3,5a,6,7,8,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419386) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is (5aR,9aR)-4-[(3-fluorophenyl)methyl]-2,3,5a,6,7,8,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-4-[(3-fluorophenyl)methyl]-2,3,5a,6,7,8,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419386 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (5aR,9aR)-4-[(3-fluorophenyl)methyl]-2,3,5a,6,7,8,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1[C@@H]2CCNC[C@@H]2OCCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN2O2/c16-12-3-1-2-11(8-12)10-18-6-7-20-14-9-17-5-4-13(14)15(18)19/h1-3,8,13-14,17H,4-7,9-10H2/t13-,14+/m1/s1 |
| InChIKey | BENHASLQQOMGBS-KGLIPLIRSA-N |
| XLogP | 1.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |