C17H24N2O4S — CID 97419381
(5aR,9aR)-4-[(3-methylphenyl)methyl]-8-methylsulfonyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419381) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (5aR,9aR)-4-[(3-methylphenyl)methyl]-8-methylsulfonyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-4-[(3-methylphenyl)methyl]-8-methylsulfonyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419381 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (5aR,9aR)-4-[(3-methylphenyl)methyl]-8-methylsulfonyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | Cc1cccc(CN2CCO[C@H]3CN(S(C)(=O)=O)CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-13-4-3-5-14(10-13)11-18-8-9-23-16-12-19(24(2,21)22)7-6-15(16)17(18)20/h3-5,10,15-16H,6-9,11-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | XBIKWFPYLNXTMC-CVEARBPZSA-N |
| XLogP | 1.00 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |