C22H24F4N2O5 — CID 155837800
1-[(5aS,8aS)-4-(furan-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(3-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155837800) has the molecular formula C22H24F4N2O5 and a molecular weight of 472.44 g/mol. Its IUPAC name is 1-[(5aS,8aS)-4-(furan-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(3-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(5aS,8aS)-4-(furan-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(3-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837800 |
| Molecular Formula | C22H24F4N2O5 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-[(5aS,8aS)-4-(furan-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(3-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1cccc(F)c1)N1C[C@@H]2CN(Cc3ccco3)CCO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23FN2O3.C2HF3O2/c21-17-4-1-3-15(9-17)10-20(24)23-12-16-11-22(6-8-26-19(16)14-23)13-18-5-2-7-25-18;3-2(4,5)1(6)7/h1-5,7,9,16,19H,6,8,10-14H2;(H,6,7)/t16-,19+;/m0./s1 |
| InChIKey | GHLOTEWVKFEYNQ-ZKKBRJJYSA-N |
| XLogP | 2.95 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |