C17H20N2O3 — CID 124787613
[(4aS,7aS)-1-(furan-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone (PubChem CID 124787613) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is [(4aS,7aS)-1-(furan-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone.
| Compound Name | [(4aS,7aS)-1-(furan-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 124787613 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [(4aS,7aS)-1-(furan-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1C[C@@H]2CCCN(Cc3ccoc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H20N2O3/c20-17(16-4-2-7-22-16)19-10-14-3-1-6-18(15(14)11-19)9-13-5-8-21-12-13/h2,4-5,7-8,12,14-15H,1,3,6,9-11H2/t14-,15+/m0/s1 |
| InChIKey | DCURVGUAFJATRT-LSDHHAIUSA-N |
| XLogP | 2.61 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |