C18H24N4O3 — CID 124817615
N-[[(3S,3aR,7aR)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]furan-2-carboxamide (PubChem CID 124817615) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[[(3S,3aR,7aR)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(3S,3aR,7aR)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124817615 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[[(3S,3aR,7aR)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]furan-2-carboxamide |
| SMILES | Cn1cc(CN2CC[C@H]3CO[C@H](CNC(=O)c4ccco4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C18H24N4O3/c1-21-9-13(7-20-21)10-22-5-4-14-12-25-17(15(14)11-22)8-19-18(23)16-3-2-6-24-16/h2-3,6-7,9,14-15,17H,4-5,8,10-12H2,1H3,(H,19,23)/t14-,15-,17+/m0/s1 |
| InChIKey | LOAYWYWCYOYIPC-YQQAZPJKSA-N |
| XLogP | 1.28 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |