C17H26N4O3 — CID 133144332
N-[[(3R,3aS,7aS)-5-(oxolan-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 133144332) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[[(3R,3aS,7aS)-5-(oxolan-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[[(3R,3aS,7aS)-5-(oxolan-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 133144332 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[[(3R,3aS,7aS)-5-(oxolan-3-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC[C@@H]2OC[C@H]3CCN(C4CCOC4)C[C@H]32)cn1 |
| InChI | InChI=1S/C17H26N4O3/c1-20-8-13(6-19-20)17(22)18-7-16-15-9-21(14-3-5-23-11-14)4-2-12(15)10-24-16/h6,8,12,14-16H,2-5,7,9-11H2,1H3,(H,18,22)/t12-,14?,15-,16+/m1/s1 |
| InChIKey | NMPHJSJJOXAOFG-OHRKKDJYSA-N |
| XLogP | 0.28 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |