C17H21N3O4 — CID 124780347
N-[[(3R,3aS,7aS)-5-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,2-oxazole-5-carboxamide (PubChem CID 124780347) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[[(3R,3aS,7aS)-5-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[[(3R,3aS,7aS)-5-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 124780347 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[[(3R,3aS,7aS)-5-(furan-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NC[C@@H]1OC[C@H]2CCN(Cc3ccco3)C[C@H]21)c1ccno1 |
| InChI | InChI=1S/C17H21N3O4/c21-17(15-3-5-19-24-15)18-8-16-14-10-20(6-4-12(14)11-23-16)9-13-2-1-7-22-13/h1-3,5,7,12,14,16H,4,6,8-11H2,(H,18,21)/t12-,14-,16+/m1/s1 |
| InChIKey | IKLJIUKZGYIPQK-XPKDYRNWSA-N |
| XLogP | 1.53 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |