C24H31N3O — CID 42244536
(3-methyl-2-pyridinyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone (PubChem CID 42244536) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is (3-methyl-2-pyridinyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone.
| Compound Name | (3-methyl-2-pyridinyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42244536 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (3-methyl-2-pyridinyl)-[4-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cccnc1C(=O)N1CCC([C@@H]2CCN(CCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C24H31N3O/c1-19-6-5-13-25-23(19)24(28)27-16-11-21(12-17-27)22-10-15-26(18-22)14-9-20-7-3-2-4-8-20/h2-8,13,21-22H,9-12,14-18H2,1H3/t22-/m1/s1 |
| InChIKey | RHUFJTLOYGHNAF-JOCHJYFZSA-N |
| XLogP | 3.81 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |