C19H29N3O2 — CID 155877497
[(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone (PubChem CID 155877497) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is [(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone.
| Compound Name | [(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 155877497 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | [(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-methyl-2-pyridinyl)methanone |
| SMILES | COCCCN1CC[C@@H]2CN(C(=O)c3ncccc3C)C[C@@H]2CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-15-5-3-8-20-18(15)19(23)22-13-16-6-10-21(9-4-12-24-2)11-7-17(16)14-22/h3,5,8,16-17H,4,6-7,9-14H2,1-2H3/t16-,17+ |
| InChIKey | GQQOKTHCALCSPE-CALCHBBNSA-N |
| XLogP | 2.21 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|