C17H25FN2O2S — CID 155877602
[(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone (PubChem CID 155877602) has the molecular formula C17H25FN2O2S and a molecular weight of 340.46 g/mol. Its IUPAC name is [(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone.
| Compound Name | [(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 155877602 |
| Molecular Formula | C17H25FN2O2S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(3aS,8aR)-6-(3-methoxypropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone |
| SMILES | COCCCN1CC[C@@H]2CN(C(=O)c3sccc3F)C[C@@H]2CC1 |
| InChI | InChI=1S/C17H25FN2O2S/c1-22-9-2-6-19-7-3-13-11-20(12-14(13)4-8-19)17(21)16-15(18)5-10-23-16/h5,10,13-14H,2-4,6-9,11-12H2,1H3/t13-,14+ |
| InChIKey | OMZCJOQRDOUZFU-OKILXGFUSA-N |
| XLogP | 2.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|