C26H41FN2O2 — CID 118486319
1-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-7-methoxyheptan-4-one (PubChem CID 118486319) has the molecular formula C26H41FN2O2 and a molecular weight of 432.62 g/mol. Its IUPAC name is 1-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-7-methoxyheptan-4-one.
| Compound Name | 1-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-7-methoxyheptan-4-one |
|---|---|
| PubChem CID | 118486319 |
| Molecular Formula | C26H41FN2O2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 1-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-7-methoxyheptan-4-one |
| SMILES | COCCCC(=O)CCCC1CCC(CCN2CCN(c3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C26H41FN2O2/c1-31-21-5-8-24(30)7-4-6-22-11-13-23(14-12-22)15-16-28-17-19-29(20-18-28)26-10-3-2-9-25(26)27/h2-3,9-10,22-23H,4-8,11-21H2,1H3 |
| InChIKey | ASGCZYYVZCDMAU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|