C18H26F2N2 — CID 91353015
1-(2-cyclohexylethyl)-4-(2,3-difluorophenyl)piperazine (PubChem CID 91353015) has the molecular formula C18H26F2N2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-4-(2,3-difluorophenyl)piperazine.
| Compound Name | 1-(2-cyclohexylethyl)-4-(2,3-difluorophenyl)piperazine |
|---|---|
| PubChem CID | 91353015 |
| Molecular Formula | C18H26F2N2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-(2-cyclohexylethyl)-4-(2,3-difluorophenyl)piperazine |
| SMILES | Fc1cccc(N2CCN(CCC3CCCCC3)CC2)c1F |
| InChI | InChI=1S/C18H26F2N2/c19-16-7-4-8-17(18(16)20)22-13-11-21(12-14-22)10-9-15-5-2-1-3-6-15/h4,7-8,15H,1-3,5-6,9-14H2 |
| InChIKey | QJGWJDIKRFKHEL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |