C10H9F2N — CID 69194042
1-(2,3-difluorophenyl)-2,5-dihydropyrrole (PubChem CID 69194042) has the molecular formula C10H9F2N and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-2,5-dihydropyrrole.
| Compound Name | 1-(2,3-difluorophenyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 69194042 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1-(2,3-difluorophenyl)-2,5-dihydropyrrole |
| SMILES | Fc1cccc(N2CC=CC2)c1F |
| InChI | InChI=1S/C10H9F2N/c11-8-4-3-5-9(10(8)12)13-6-1-2-7-13/h1-5H,6-7H2 |
| InChIKey | GKOVXKAPAWCMCD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|