C18H26F2N2 — CID 83998643
N-(cyclohexylmethyl)-1-(2,3-difluorophenyl)piperidin-3-amine (PubChem CID 83998643) has the molecular formula C18H26F2N2 and a molecular weight of 308.42 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-(2,3-difluorophenyl)piperidin-3-amine.
| Compound Name | N-(cyclohexylmethyl)-1-(2,3-difluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83998643 |
| Molecular Formula | C18H26F2N2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-(cyclohexylmethyl)-1-(2,3-difluorophenyl)piperidin-3-amine |
| SMILES | Fc1cccc(N2CCCC(NCC3CCCCC3)C2)c1F |
| InChI | InChI=1S/C18H26F2N2/c19-16-9-4-10-17(18(16)20)22-11-5-8-15(13-22)21-12-14-6-2-1-3-7-14/h4,9-10,14-15,21H,1-3,5-8,11-13H2 |
| InChIKey | HPDULUFWNRCDHC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |