C17H24F2N2 — CID 83999334
N-cyclohexyl-1-(2,3-difluorophenyl)piperidin-3-amine (PubChem CID 83999334) has the molecular formula C17H24F2N2 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-cyclohexyl-1-(2,3-difluorophenyl)piperidin-3-amine.
| Compound Name | N-cyclohexyl-1-(2,3-difluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83999334 |
| Molecular Formula | C17H24F2N2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-cyclohexyl-1-(2,3-difluorophenyl)piperidin-3-amine |
| SMILES | Fc1cccc(N2CCCC(NC3CCCCC3)C2)c1F |
| InChI | InChI=1S/C17H24F2N2/c18-15-9-4-10-16(17(15)19)21-11-5-8-14(12-21)20-13-6-2-1-3-7-13/h4,9-10,13-14,20H,1-3,5-8,11-12H2 |
| InChIKey | RVOJPFIPCKWENF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |