C15H24N2S — CID 83999299
N-cyclohexyl-1-thiophen-3-ylpiperidin-3-amine (PubChem CID 83999299) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is N-cyclohexyl-1-thiophen-3-ylpiperidin-3-amine.
| Compound Name | N-cyclohexyl-1-thiophen-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 83999299 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | N-cyclohexyl-1-thiophen-3-ylpiperidin-3-amine |
| SMILES | c1cc(N2CCCC(NC3CCCCC3)C2)cs1 |
| InChI | InChI=1S/C15H24N2S/c1-2-5-13(6-3-1)16-14-7-4-9-17(11-14)15-8-10-18-12-15/h8,10,12-14,16H,1-7,9,11H2 |
| InChIKey | CRPZXHXGAGWMFQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |