C11H16F2N2S — CID 83993075
N-(2,2-difluoroethyl)-1-thiophen-3-ylpiperidin-3-amine (PubChem CID 83993075) has the molecular formula C11H16F2N2S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-thiophen-3-ylpiperidin-3-amine.
| Compound Name | N-(2,2-difluoroethyl)-1-thiophen-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 83993075 |
| Molecular Formula | C11H16F2N2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-thiophen-3-ylpiperidin-3-amine |
| SMILES | FC(F)CNC1CCCN(c2ccsc2)C1 |
| InChI | InChI=1S/C11H16F2N2S/c12-11(13)6-14-9-2-1-4-15(7-9)10-3-5-16-8-10/h3,5,8-9,11,14H,1-2,4,6-7H2 |
| InChIKey | LAAFWCJURHBNGJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |