C17H23FN2O — CID 83997186
[3-(cyclobutylmethylamino)piperidin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 83997186) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is [3-(cyclobutylmethylamino)piperidin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [3-(cyclobutylmethylamino)piperidin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 83997186 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | [3-(cyclobutylmethylamino)piperidin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCCC(NCC2CCC2)C1 |
| InChI | InChI=1S/C17H23FN2O/c18-16-9-2-1-8-15(16)17(21)20-10-4-7-14(12-20)19-11-13-5-3-6-13/h1-2,8-9,13-14,19H,3-7,10-12H2 |
| InChIKey | MWTNYPFWVMSKSO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |