C25H36FN3O2 — CID 46024614
N-(cyclohexylmethyl)-2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]acetamide (PubChem CID 46024614) has the molecular formula C25H36FN3O2 and a molecular weight of 429.58 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46024614 |
| Molecular Formula | C25H36FN3O2 |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | N-(cyclohexylmethyl)-2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]acetamide |
| SMILES | O=C(NCC1CCCCC1)C(C1CCCC1)N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H36FN3O2/c26-22-13-7-6-12-21(22)25(31)29-16-14-28(15-17-29)23(20-10-4-5-11-20)24(30)27-18-19-8-2-1-3-9-19/h6-7,12-13,19-20,23H,1-5,8-11,14-18H2,(H,27,30) |
| InChIKey | YMFHACJJJTZOOA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |