C27H34FN3O3 — CID 42842706
2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 42842706) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 42842706 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-cyclopentyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)C(C2CCCC2)N2CCN(C(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C27H34FN3O3/c1-34-22-12-10-20(11-13-22)14-15-29-26(32)25(21-6-2-3-7-21)30-16-18-31(19-17-30)27(33)23-8-4-5-9-24(23)28/h4-5,8-13,21,25H,2-3,6-7,14-19H2,1H3,(H,29,32) |
| InChIKey | ZVWWYVPZPSBVIM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |