C26H32ClN3O2 — CID 93209331
(2R)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(2-phenylethyl)acetamide (PubChem CID 93209331) has the molecular formula C26H32ClN3O2 and a molecular weight of 454.01 g/mol. Its IUPAC name is (2R)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(2-phenylethyl)acetamide.
| Compound Name | (2R)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 93209331 |
| Molecular Formula | C26H32ClN3O2 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (2R)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(2-phenylethyl)acetamide |
| SMILES | O=C(NCCc1ccccc1)[C@@H](C1CCCC1)N1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H32ClN3O2/c27-23-13-7-6-12-22(23)26(32)30-18-16-29(17-19-30)24(21-10-4-5-11-21)25(31)28-15-14-20-8-2-1-3-9-20/h1-3,6-9,12-13,21,24H,4-5,10-11,14-19H2,(H,28,31)/t24-/m1/s1 |
| InChIKey | CKTQMQHXVBFEEZ-XMMPIXPASA-N |
| XLogP | 4.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |