C21H28ClN3O2 — CID 46024550
2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide (PubChem CID 46024550) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 46024550 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-2-11-23-20(26)19(16-7-3-4-8-16)24-12-14-25(15-13-24)21(27)17-9-5-6-10-18(17)22/h2,5-6,9-10,16,19H,1,3-4,7-8,11-15H2,(H,23,26) |
| InChIKey | ZDNBPRAJCACWEX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|