C22H31FN4O2 — CID 93221335
4-[(1S)-1-cyclopentyl-2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-N-prop-2-enylpiperazine-1-carboxamide (PubChem CID 93221335) has the molecular formula C22H31FN4O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 4-[(1S)-1-cyclopentyl-2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-N-prop-2-enylpiperazine-1-carboxamide.
| Compound Name | 4-[(1S)-1-cyclopentyl-2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-N-prop-2-enylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 93221335 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-[(1S)-1-cyclopentyl-2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-N-prop-2-enylpiperazine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCN([C@H](C(=O)NCc2ccccc2F)C2CCCC2)CC1 |
| InChI | InChI=1S/C22H31FN4O2/c1-2-11-24-22(29)27-14-12-26(13-15-27)20(17-7-3-4-8-17)21(28)25-16-18-9-5-6-10-19(18)23/h2,5-6,9-10,17,20H,1,3-4,7-8,11-16H2,(H,24,29)(H,25,28)/t20-/m0/s1 |
| InChIKey | HYBUGGLQPBXWLG-FQEVSTJZSA-N |
| XLogP | 2.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|