C22H29N3O4 — CID 46024558
2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide (PubChem CID 46024558) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 46024558 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-cyclopentyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H29N3O4/c1-2-9-23-21(26)20(16-5-3-4-6-16)24-10-12-25(13-11-24)22(27)17-7-8-18-19(14-17)29-15-28-18/h2,7-8,14,16,20H,1,3-6,9-13,15H2,(H,23,26) |
| InChIKey | KFCBEKGMVLTBSL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|