C24H35N3O2 — CID 93210063
(2S)-2-cyclopentyl-N-(cyclopropylmethyl)-2-[4-(3-phenylpropanoyl)piperazin-1-yl]acetamide (PubChem CID 93210063) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-N-(cyclopropylmethyl)-2-[4-(3-phenylpropanoyl)piperazin-1-yl]acetamide.
| Compound Name | (2S)-2-cyclopentyl-N-(cyclopropylmethyl)-2-[4-(3-phenylpropanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 93210063 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (2S)-2-cyclopentyl-N-(cyclopropylmethyl)-2-[4-(3-phenylpropanoyl)piperazin-1-yl]acetamide |
| SMILES | O=C(NCC1CC1)[C@H](C1CCCC1)N1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H35N3O2/c28-22(13-12-19-6-2-1-3-7-19)26-14-16-27(17-15-26)23(21-8-4-5-9-21)24(29)25-18-20-10-11-20/h1-3,6-7,20-21,23H,4-5,8-18H2,(H,25,29)/t23-/m0/s1 |
| InChIKey | CCPKFUWLJNNXQG-QHCPKHFHSA-N |
| XLogP | 2.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |