C19H27F3N2 — CID 143598821
1-[2-(4-methylcyclohexyl)ethyl]-4-(2,4,5-trifluorophenyl)piperazine (PubChem CID 143598821) has the molecular formula C19H27F3N2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[2-(4-methylcyclohexyl)ethyl]-4-(2,4,5-trifluorophenyl)piperazine.
| Compound Name | 1-[2-(4-methylcyclohexyl)ethyl]-4-(2,4,5-trifluorophenyl)piperazine |
|---|---|
| PubChem CID | 143598821 |
| Molecular Formula | C19H27F3N2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 1-[2-(4-methylcyclohexyl)ethyl]-4-(2,4,5-trifluorophenyl)piperazine |
| SMILES | CC1CCC(CCN2CCN(c3cc(F)c(F)cc3F)CC2)CC1 |
| InChI | InChI=1S/C19H27F3N2/c1-14-2-4-15(5-3-14)6-7-23-8-10-24(11-9-23)19-13-17(21)16(20)12-18(19)22/h12-15H,2-11H2,1H3 |
| InChIKey | UTWMYFZBDIJDCU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|