About 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile
1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile (PubChem CID 143598669) has the molecular formula C24H36FN3O
and a molecular weight of 401.57 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile.
Molecular Properties
| Compound Name | 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile |
| PubChem CID | 143598669 |
| Molecular Formula | C24H36FN3O |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile |
| SMILES | CC(=O)CC#N.Cc1ccc(F)cc1N1CCN(CCC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C20H31FN2.C4H5NO/c1-16-3-6-18(7-4-16)9-10-22-11-13-23(14-12-22)20-15-19(21)8-5-17(20)2;1-4(6)2-3-5/h5,8,15-16,18H,3-4,6-7,9-14H2,1-2H3;2H2,1H3 |
| InChIKey | ZYEOUSZPMSIINL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile?
The IUPAC name of 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile (CID 143598669) is 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile.
What is the SMILES notation for 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile?
The canonical SMILES for 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile is CC(=O)CC#N.Cc1ccc(F)cc1N1CCN(CCC2CCC(C)CC2)CC1.
What is the InChIKey of 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile?
The InChIKey is ZYEOUSZPMSIINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31FN2.C4H5NO/c1-16-3-6-18(7-4-16)9-10-22-11-13-23(14-12-22)20-15-19(21)8-5-17(20)2;1-4(6)2-3-5/h5,8,15-16,18H,3-4,6-7,9-14H2,1-2H3;2H2,1H3.
What are the key properties of 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile?
1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile has a molecular weight of 401.57 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-2-methylphenyl)-4-[2-(4-methylcyclohexyl)ethyl]piperazine;3-oxobutanenitrile is sourced from PubChem (CID 143598669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).