C14H19F3N2 — CID 62809717
3,7-dimethyl-1-(2,4,5-trifluorophenyl)-1,5-diazocane (PubChem CID 62809717) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2,4,5-trifluorophenyl)-1,5-diazocane.
| Compound Name | 3,7-dimethyl-1-(2,4,5-trifluorophenyl)-1,5-diazocane |
|---|---|
| PubChem CID | 62809717 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3,7-dimethyl-1-(2,4,5-trifluorophenyl)-1,5-diazocane |
| SMILES | CC1CNCC(C)CN(c2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C14H19F3N2/c1-9-5-18-6-10(2)8-19(7-9)14-4-12(16)11(15)3-13(14)17/h3-4,9-10,18H,5-8H2,1-2H3 |
| InChIKey | INBBXDFUYZKRBS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|