C19H27FN2OS — CID 155877937
[(3aS,8aR)-6-(cyclopentylmethyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone (PubChem CID 155877937) has the molecular formula C19H27FN2OS and a molecular weight of 350.50 g/mol. Its IUPAC name is [(3aS,8aR)-6-(cyclopentylmethyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone.
| Compound Name | [(3aS,8aR)-6-(cyclopentylmethyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 155877937 |
| Molecular Formula | C19H27FN2OS |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [(3aS,8aR)-6-(cyclopentylmethyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(3-fluorothiophen-2-yl)methanone |
| SMILES | O=C(c1sccc1F)N1C[C@H]2CCN(CC3CCCC3)CC[C@H]2C1 |
| InChI | InChI=1S/C19H27FN2OS/c20-17-7-10-24-18(17)19(23)22-12-15-5-8-21(9-6-16(15)13-22)11-14-3-1-2-4-14/h7,10,14-16H,1-6,8-9,11-13H2/t15-,16+ |
| InChIKey | AAGRXNZRHYSQGO-IYBDPMFKSA-N |
| XLogP | 3.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |