C18H26FN3O — CID 124808474
[(3aS,7aS)-5-[2-(dimethylamino)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(2-fluorophenyl)methanone (PubChem CID 124808474) has the molecular formula C18H26FN3O and a molecular weight of 319.42 g/mol. Its IUPAC name is [(3aS,7aS)-5-[2-(dimethylamino)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3aS,7aS)-5-[2-(dimethylamino)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 124808474 |
| Molecular Formula | C18H26FN3O |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | [(3aS,7aS)-5-[2-(dimethylamino)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(2-fluorophenyl)methanone |
| SMILES | CN(C)CCN1CC[C@@H]2CN(C(=O)c3ccccc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C18H26FN3O/c1-20(2)9-10-21-8-7-14-12-22(13-15(14)11-21)18(23)16-5-3-4-6-17(16)19/h3-6,14-15H,7-13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | RDAPMXKZSHJJQP-CABCVRRESA-N |
| XLogP | 1.78 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |