C17H24N4O — CID 97457905
[(3aR,6aS)-2-(cyclopentylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone (PubChem CID 97457905) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is [(3aR,6aS)-2-(cyclopentylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3aR,6aS)-2-(cyclopentylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 97457905 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [(3aR,6aS)-2-(cyclopentylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1C[C@H]2CN(CC3CCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C17H24N4O/c22-17(16-7-18-5-6-19-16)21-11-14-9-20(10-15(14)12-21)8-13-3-1-2-4-13/h5-7,13-15H,1-4,8-12H2/t14-,15+ |
| InChIKey | GUBREGSKFCMKFZ-GASCZTMLSA-N |
| XLogP | 1.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |