C16H18N6O — CID 124794019
[(3aS,7aS)-5-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-pyrazin-2-ylmethanone (PubChem CID 124794019) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is [(3aS,7aS)-5-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3aS,7aS)-5-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124794019 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [(3aS,7aS)-5-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1C[C@H]2CCN(c3ncccn3)C[C@H]2C1 |
| InChI | InChI=1S/C16H18N6O/c23-15(14-8-17-5-6-18-14)22-9-12-2-7-21(10-13(12)11-22)16-19-3-1-4-20-16/h1,3-6,8,12-13H,2,7,9-11H2/t12-,13+/m1/s1 |
| InChIKey | PVMMFJHZANLCTH-OLZOCXBDSA-N |
| XLogP | 0.87 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |