C18H24N4O2 — CID 131689109
[(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-methylcyclobutyl)methanone (PubChem CID 131689109) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is [(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-methylcyclobutyl)methanone.
| Compound Name | [(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-methylcyclobutyl)methanone |
|---|---|
| PubChem CID | 131689109 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-methylcyclobutyl)methanone |
| SMILES | CC1CC(C(=O)N2C[C@H]3CCN(C(=O)c4cnccn4)C[C@@H]3C2)C1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-6-14(7-12)17(23)22-9-13-2-5-21(10-15(13)11-22)18(24)16-8-19-3-4-20-16/h3-4,8,12-15H,2,5-7,9-11H2,1H3/t12?,13-,14?,15-/m1/s1 |
| InChIKey | LUGQQYCLASVHRE-HXSCFSKGSA-N |
| XLogP | 1.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |