C17H24N4O2 — CID 816652
(4-methylpiperidin-1-yl)-[(3R)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone (PubChem CID 816652) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[(3R)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[(3R)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 816652 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[(3R)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone |
| SMILES | CC1CCN(C(=O)[C@@H]2CCCN(C(=O)c3cnccn3)C2)CC1 |
| InChI | InChI=1S/C17H24N4O2/c1-13-4-9-20(10-5-13)16(22)14-3-2-8-21(12-14)17(23)15-11-18-6-7-19-15/h6-7,11,13-14H,2-5,8-10,12H2,1H3/t14-/m1/s1 |
| InChIKey | YXFUOWFCWZLQQE-CQSZACIVSA-N |
| XLogP | 1.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |