C21H24ClN5O2 — CID 1031812
[4-(2-chlorophenyl)piperazin-1-yl]-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone (PubChem CID 1031812) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 1031812 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1cnccn1)N1CCC[C@H](C(=O)N2CCN(c3ccccc3Cl)CC2)C1 |
| InChI | InChI=1S/C21H24ClN5O2/c22-17-5-1-2-6-19(17)25-10-12-26(13-11-25)20(28)16-4-3-9-27(15-16)21(29)18-14-23-7-8-24-18/h1-2,5-8,14,16H,3-4,9-13,15H2/t16-/m0/s1 |
| InChIKey | UENRPAIXHLJLIP-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |